Technical Specifications：
| Size Range | NPS 1-1/2” - 16” |
| Pressure Rating | PN16/25/40/63/100; CLASS150(PN20)/300(PN50)/600(PN110) |
| Temperature Rating | -80℃~ 260℃ |
| Rangeability | 50:1 |
| Seat Leakage Class | ANSI B16.104: IV、V、VI |
| Main Material | Carbon Steel, Stainless Steel, Duplex steel etc. |
| Trim Material | 630/316/316+STL/316(nitriding)/316+Ni60/316+WC etc. |
| Seal Material | PTFE+ graphite v-shaped packing, flexible graphite ring packing, graphite +PTFE braided packing etc. |
Feature of Cage Guided Globe Control Valves：
Precision Control: The cage structure ensures optimal alignment of the valve plug, enabling precise fluid/gas flow regulation with minimized leakage risk.
Operational Stability: Reduced vibration during operation enhances durability and lowers maintenance frequency.
Extended Lifespan: Cage-guided motion significantly diminishes wear on sealing components, boosting longevity.
Cavitation & Noise Mitigation: Specialized cage designs counteract cavitation-induced damage and operational noise.
Industries such as oil & gas, chemical processing, and power generation rely on these valves for their unmatched reliability in critical applications.
FAQs
1. What does "cage guided" mean, and how is it different from stem-guided or post-guided designs?
A cage-guided design uses a cylindrical cage sleeve surrounding the plug to keep it aligned throughout its travel, rather than relying solely on the stem or a top/bottom guide post — this generally gives more stable, vibration-resistant travel at high pressure drops than simpler guiding methods.
2. What does a rangeability of 50:1 actually mean for my process?
It's the ratio between the maximum and minimum flow the valve can control accurately — a 50:1 rangeability means the valve holds precise control across a wide swing in flow demand, which matters in processes where flow rate varies significantly rather than staying near one fixed setpoint.
3. How do I know which seat leakage class (IV, V, or VI) I need?
Class IV allows a small amount of leakage in the closed position and suits most general control applications; Class V and especially Class VI are specified where near-zero leakage matters for safety, environmental, or product-purity reasons — the tighter class typically comes with added cost and trim complexity.
4. What causes cavitation in a control valve, and how does this design address it?
Cavitation happens when a pressure drop causes localized vapor bubbles to form and then violently collapse as pressure recovers downstream, which erodes trim surfaces over time — a cage design with a specialized flow path breaks the pressure drop into stages, reducing the severity of that collapse compared to a simple single-stage orifice.
5. Can the trim material be changed without switching the whole valve body?
Yes — trim materials (316, hardened 316, Ni60 or WC overlay) are typically selectable independently of the base body material, so the same valve platform can be configured for erosive, corrosive, or high-cycling service by changing only the plug/seat trim rather than the entire valve.
Request a Quote
